CAS 951657-98-0 is the registry number for 5–(4–Bromophenyl)picolinonitrile. Offered by: GLPBio. Available pack sizes: 1g, 250mg.
5-(4-bromophenyl)pyridine-2-carbonitrile (CAS 951657-98-0) is a chemical compound with the molecular formula C12H7BrN2 and a molecular weight of 259.10 g/mol. IUPAC name: 5-(4-bromophenyl)pyridine-2-carbonitrile. InChIKey: MJJRGULVLNAVGL-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 5-(4-bromophenyl)pyridine-2-carbonitrile |
| InChIKey | MJJRGULVLNAVGL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(C=C2)C#N)Br |
Computed by PubChem (NCBI)