CAS 7089-67-0 appears in our catalog under these names: 4–bromo–1,10–phenanthroline, 4-Bromo-1,10-phenanthroline, >95.0%(HPLC)(T), 4-Bromo-1,10-phenanthroline 98%, 4-Bromo-1,10-phenanthroline, 98%, 98%, 4-Bromo-1,10-phenanthroline, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 200mg, 100mg, 5g.
4-bromo-1,10-phenanthroline (CAS 7089-67-0) is a chemical compound with the molecular formula C12H7BrN2 and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromo-1,10-phenanthroline. InChIKey: WITRVHHXXZEEPD-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-bromo-1,10-phenanthroline |
| InChIKey | WITRVHHXXZEEPD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=NC=CC(=C3C=C2)Br)N=C1 |
Computed by PubChem (NCBI)