CAS 66127-01-3 appears in our catalog under these names: 3–Bromo–1,10–phenanthroline, 3-Bromo-1,10-phenanthroline 95%, 3-Bromo-1,10-phenanthroline, 98%, 1,10-Phenanthroline, 3-bromo-, 95%, 95%, 3-Bromo-1,10-phenanthroline, >98.0%(HPLC)(T). Offered by: GLPBio, Ambeed, Fluorochem, Chemat, TCI. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g, 200mg.
3-bromo-1,10-phenanthroline (CAS 66127-01-3) is a chemical compound with the molecular formula C12H7BrN2 and a molecular weight of 259.10 g/mol. IUPAC name: 3-bromo-1,10-phenanthroline. InChIKey: OADZHFGJIVKDJN-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 3-bromo-1,10-phenanthroline |
| InChIKey | OADZHFGJIVKDJN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=NC=C(C=C3C=C2)Br)N=C1 |
Computed by PubChem (NCBI)