CAS 40000-20-2 appears in our catalog under these names: 5–Bromo–1,10–phenanthroline, 5-Bromo-1,10-phenanthroline, >98.0%(T), 5-Bromo-1,10-phenanthroline 97%, 1,10-Phenanthroline, 5-bromo-, 97%, 97%, 5-Bromo-1,10-phenanthroline, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 200mg, 1g, 500g, 250mg, 100g.
5-bromo-1,10-phenanthroline (CAS 40000-20-2) is a chemical compound with the molecular formula C12H7BrN2 and a molecular weight of 259.10 g/mol. IUPAC name: 5-bromo-1,10-phenanthroline. InChIKey: GWKGPQCKIBRXGW-UHFFFAOYSA-N.
| Molecular formula | C12H7BrN2 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 5-bromo-1,10-phenanthroline |
| InChIKey | GWKGPQCKIBRXGW-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=C3C=CC=NC3=C2N=C1)Br |
Computed by PubChem (NCBI)