CAS 33331-59-8 is the registry number for Nalidixic Acid Ethyl Ester. Offered by: Chemat Brand, Mikromol, Biosynth. Available pack sizes: on request, 25mg, 10mg, 50mg.
Ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate (CAS 33331-59-8) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate. InChIKey: WZPCSVBNEQYORT-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | ethyl 1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carboxylate |
| InChIKey | WZPCSVBNEQYORT-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=C1N=C(C=C2)C)C(=O)OCC |
Computed by PubChem (NCBI)