CAS 333350-60-0 appears in our catalog under these names: Dabigatran Etexilate Impurity 2, 4-Methoxy-N-methyl-3-nitrobenzamide, 98%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g.
4-methoxy-N-methyl-3-nitrobenzamide (CAS 333350-60-0) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: 4-methoxy-N-methyl-3-nitrobenzamide. InChIKey: SUAZPYJJKLOXQK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | 4-methoxy-N-methyl-3-nitrobenzamide |
| InChIKey | SUAZPYJJKLOXQK-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)