CAS 33421-36-2 appears in our catalog under these names: 2-(Pyridin-2-yl)phenol 97%, 2-(Pyridin-2-yl)phenol, 95%, 2-(Pyridin-2-yl)phenol, 95-<97%, 2-(Pyridin-2-yl)phenol, ≥97-<99%, 2-(Pyridin-2-yl)phenol, 97%, 97%. Offered by: Ambeed, Fluorochem, Hoffman Fine Chemicals, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 50g, 100g, 200g.
2-pyridin-2-ylphenol (CAS 33421-36-2) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 2-pyridin-2-ylphenol. InChIKey: HPDNGBIRSIWOST-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 2-pyridin-2-ylphenol |
| InChIKey | HPDNGBIRSIWOST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)O |
Computed by PubChem (NCBI)