CAS 3367-88-2 appears in our catalog under these names: 3-(pyridin-2-ylmethylidene)-1,3-dihydro-2H-indol-2-one, 97%, 97%, (E/Z)–GSK–3β inhibitor 1, (E/Z)-GSK-3β inhibitor 1/ 99.8% (existing batch purity), (E/Z)-GSK-3β inhibitor 1, 99.10%. Offered by: Chemat, GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg, 200mg.
(3Z)-3-(pyridin-2-ylmethylidene)-1H-indol-2-one (CAS 3367-88-2) is a chemical compound with the molecular formula C14H10N2O and a molecular weight of 222.24 g/mol. IUPAC name: (3Z)-3-(pyridin-2-ylmethylidene)-1H-indol-2-one. InChIKey: YKQONSWBHGBDSB-XFXZXTDPSA-N.
| Molecular formula | C14H10N2O |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | (3Z)-3-(pyridin-2-ylmethylidene)-1H-indol-2-one |
| InChIKey | YKQONSWBHGBDSB-XFXZXTDPSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=CC=CC=N3)/C(=O)N2 |
Computed by PubChem (NCBI)