Products 33741-78-5
CAS 33741-78-5 appears in our catalog under these names: Amino-naphthalen-2-yl-acetic acid, 95%, 2–Amino–2–(naphthalen–2–yl)acetic acid, Amino(naphthalen-2-yl)acetic acid, H-DL-Gly(2-Naphthyl)-OH, 95%, 2-Amino-2-(naphthalen-2-yl)acetic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, BLDpharm. Available pack sizes: 1g, 250mg, 100mg, 5g, 500mg, 1000mg, 2000mg, 50mg.
2-amino-2-naphthalen-2-ylacetic acid (CAS 33741-78-5) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 2-amino-2-naphthalen-2-ylacetic acid. InChIKey: XAJPMFUAJFQIIT-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 2-amino-2-naphthalen-2-ylacetic acid |
| InChIKey | XAJPMFUAJFQIIT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)