CAS 338998-93-9 appears in our catalog under these names: 4,4,5,5–Tetramethyl–2–(5–methylfuran–2–yl)–1,3,2–dioxaborolane, 5-Methylfuran-2-boronic acid pinacol ester, 97% , 4,4,5,5-Tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane, >97.0%(GC)(T), 2-Methylfurane-5-boronic acid pinacol ester, 95%, 95%, 4,4,5,5-Tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 10g, 500g.
4,4,5,5-tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane (CAS 338998-93-9) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane. InChIKey: FNPZFZKLYGWKLH-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(5-methylfuran-2-yl)-1,3,2-dioxaborolane |
| InChIKey | FNPZFZKLYGWKLH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(O2)C |
Computed by PubChem (NCBI)