Products 339292-55-6

CAS 339292-55-6 is the registry number for Sulfasalazine Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-chloro-N-pyridin-2-ylbenzenesulfonamide (CAS 339292-55-6) is a chemical compound with the molecular formula C11H9ClN2O2S and a molecular weight of 268.72 g/mol. IUPAC name: 2-chloro-N-pyridin-2-ylbenzenesulfonamide. InChIKey: MERVJTPMBGNSTR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9ClN2O2S
Molecular weight268.72 g/mol
IUPAC name2-chloro-N-pyridin-2-ylbenzenesulfonamide
InChIKeyMERVJTPMBGNSTR-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)S(=O)(=O)NC2=CC=CC=N2)Cl

Computed by PubChem (NCBI)