Products 341556-83-0
CAS 341556-83-0 is the registry number for (2E,2'E)-3,3'-(NAPHTHALENE-1,4-DIYL)DIACRYLIC ACID, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-[4-[(E)-2-carboxyethenyl]naphthalen-1-yl]prop-2-enoic acid (CAS 341556-83-0) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: (E)-3-[4-[(E)-2-carboxyethenyl]naphthalen-1-yl]prop-2-enoic acid. InChIKey: BXZQNBQBZLWKSR-FIFLTTCUSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | (E)-3-[4-[(E)-2-carboxyethenyl]naphthalen-1-yl]prop-2-enoic acid |
| InChIKey | BXZQNBQBZLWKSR-FIFLTTCUSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2/C=C/C(=O)O)/C=C/C(=O)O |
Computed by PubChem (NCBI)