Products 34183-01-2
CAS 34183-01-2 appears in our catalog under these names: Fenofibrate Impurity 23, Fenofibrate Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.
(2,4-dichlorophenyl)-(4-hydroxyphenyl)methanone (CAS 34183-01-2) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: (2,4-dichlorophenyl)-(4-hydroxyphenyl)methanone. InChIKey: JAMXQHSUUYEFGH-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | (2,4-dichlorophenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | JAMXQHSUUYEFGH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)