Products 34279-44-2
CAS 34279-44-2 is the registry number for (±)-Dehydroaltenusin. Offered by: MedChemExpress. Available pack sizes: Get quote.
3,7-dihydroxy-9-methoxy-4a-methylbenzo[c]chromene-2,6-dione (CAS 34279-44-2) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 3,7-dihydroxy-9-methoxy-4a-methylbenzo[c]chromene-2,6-dione. InChIKey: YWYZLBQRCUAQAV-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 3,7-dihydroxy-9-methoxy-4a-methylbenzo[c]chromene-2,6-dione |
| InChIKey | YWYZLBQRCUAQAV-UHFFFAOYSA-N |
| SMILES | CC12C=C(C(=O)C=C1C3=C(C(=CC(=C3)OC)O)C(=O)O2)O |
Computed by PubChem (NCBI)