CAS 3431-62-7 appears in our catalog under these names: 3-Nitrobenzaldoxime, 95%, 3-Nitrobenzaldoxime, 97%, 97%, 3-Nitrobenzaldoxime, 90.00%. Offered by: Combi-blocks, Chemat, MedChemExpress. Available pack sizes: 25g, 100g, 1g, 5g, 10g, Get quote.
N-[(3-nitrophenyl)methylidene]hydroxylamine (CAS 3431-62-7) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: N-[(3-nitrophenyl)methylidene]hydroxylamine. InChIKey: GQMMRLBWXCGBEV-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | N-[(3-nitrophenyl)methylidene]hydroxylamine |
| InChIKey | GQMMRLBWXCGBEV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C=NO |
Computed by PubChem (NCBI)