CAS 3717-29-1 appears in our catalog under these names: Syn-3-nitrobenzaldoxime, 98%, syn–3–Nitrobenzaldoxime, syn-3-Nitrobenzaldoxime, >98.0%(GC), syn-3-Nitrobenzaldoxime, syn-3-Nitrobenzaldoxime, 98.0%, 98.0%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Chemat. Available pack sizes: 25g, 5g, 1g, 10g.
(NE)-N-[(3-nitrophenyl)methylidene]hydroxylamine (CAS 3717-29-1) is a chemical compound with the molecular formula C7H6N2O3 and a molecular weight of 166.13 g/mol. IUPAC name: (NE)-N-[(3-nitrophenyl)methylidene]hydroxylamine. InChIKey: GQMMRLBWXCGBEV-VMPITWQZSA-N.
| Molecular formula | C7H6N2O3 |
|---|---|
| Molecular weight | 166.13 g/mol |
| IUPAC name | (NE)-N-[(3-nitrophenyl)methylidene]hydroxylamine |
| InChIKey | GQMMRLBWXCGBEV-VMPITWQZSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])/C=N/O |
Computed by PubChem (NCBI)