CAS 343374-44-7 is the registry number for (5-(2-Chlorophenyl)-1,2-oxazol-3-yl)methanol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanol (CAS 343374-44-7) is a chemical compound with the molecular formula C10H8ClNO2 and a molecular weight of 209.63 g/mol. IUPAC name: [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanol. InChIKey: UDPYKKBQLZVOPM-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO2 |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | [5-(2-chlorophenyl)-1,2-oxazol-3-yl]methanol |
| InChIKey | UDPYKKBQLZVOPM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=NO2)CO)Cl |
Computed by PubChem (NCBI)