CAS 3440-28-6 appears in our catalog under these names: Betamipron/ 99.91% (existing batch purity), Betamipron, Betamipron, >98.0%(HPLC)(T), Betamipron 98%, 3-benzamidopropanoic acid, 98%, 98%. Offered by: TargetMol, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 200mg, 500mg, 10mM (in 1ml dmso), 5g, 25g, 25mg.
Betamipron is an organonitrogen compound and an organooxygen compound. It is functionally related to a beta-amino acid.
Source: ChEBI
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-benzamidopropanoic acid |
| InChIKey | CWXYHOHYCJXYFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCC(=O)O |
Computed by PubChem (NCBI)