Products 34425-63-3
CAS 34425-63-3 appears in our catalog under these names: 5-Hydroxyalizarin 1-methyl ether, 2,5-dihydroxy-1-methoxy-anthraquinone, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: 10 mg, 5 mg, 1 mg, 5mg.
2,5-dihydroxy-1-methoxyanthracene-9,10-dione (CAS 34425-63-3) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: 2,5-dihydroxy-1-methoxyanthracene-9,10-dione. InChIKey: PIYPSEKICNYSKT-UHFFFAOYSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 2,5-dihydroxy-1-methoxyanthracene-9,10-dione |
| InChIKey | PIYPSEKICNYSKT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC2=C1C(=O)C3=C(C2=O)C(=CC=C3)O)O |
Computed by PubChem (NCBI)