Products 345222-92-6
CAS 345222-92-6 is the registry number for Steroid sulfatase-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
(9-oxo-8-oxatricyclo[8.8.0.02,7]octadeca-1(10),2(7),3,5-tetraen-5-yl) sulfamate (CAS 345222-92-6) is a chemical compound with the molecular formula C17H21NO5S and a molecular weight of 351.4 g/mol. IUPAC name: (9-oxo-8-oxatricyclo[8.8.0.02,7]octadeca-1(10),2(7),3,5-tetraen-5-yl) sulfamate. InChIKey: KJQKHOKMGWLAME-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (9-oxo-8-oxatricyclo[8.8.0.02,7]octadeca-1(10),2(7),3,5-tetraen-5-yl) sulfamate |
| InChIKey | KJQKHOKMGWLAME-UHFFFAOYSA-N |
| SMILES | C1CCCCC2=C(CCC1)C3=C(C=C(C=C3)OS(=O)(=O)N)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
Steroid sulfatase-IN-8, orb2565245