CAS 899710-18-0 is the registry number for 5-(N-Cyclohexyl-N-methylsulfamoyl)-3-methylbenzofuran-2-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[cyclohexyl(methyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid (CAS 899710-18-0) is a chemical compound with the molecular formula C17H21NO5S and a molecular weight of 351.4 g/mol. IUPAC name: 5-[cyclohexyl(methyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: GEJHWURZGSHQBU-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 5-[cyclohexyl(methyl)sulfamoyl]-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | GEJHWURZGSHQBU-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=C(C=C2)S(=O)(=O)N(C)C3CCCCC3)C(=O)O |
Computed by PubChem (NCBI)