CAS 41036-32-2 appears in our catalog under these names: D-Alanine Benzyl Ester p-Toluenesulfonate Salt, H–D–Ala–OBzl·TosOH, H-D-Ala-OBzl*Tos, D-Alanine Benzyl Ester p-Toluenesulfonate, >98.0%(HPLC)(T), H-D-Ala-OBzl·TosOH 98%. Offered by: TRC, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 5g, 25g, 10g, 1g, 100g, 500g.
Benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid (CAS 41036-32-2) is a chemical compound with the molecular formula C17H21NO5S and a molecular weight of 351.4 g/mol. IUPAC name: benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid. InChIKey: NWOPHJSSBMABBD-DDWIOCJRSA-N.
| Molecular formula | C17H21NO5S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | benzyl (2R)-2-aminopropanoate;4-methylbenzenesulfonic acid |
| InChIKey | NWOPHJSSBMABBD-DDWIOCJRSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C[C@H](C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)