Products 35386-78-8
CAS 35386-78-8 is the registry number for Benzyl 2-aminopropanoate 4-methylbenzenesulfonate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid (CAS 35386-78-8) is a chemical compound with the molecular formula C17H21NO5S and a molecular weight of 351.4 g/mol. IUPAC name: benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid. InChIKey: NWOPHJSSBMABBD-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid |
| InChIKey | NWOPHJSSBMABBD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)
Synonyms:
O-Benzyl-L-alanine toluene-p-sulphonate, Benzyl 2-aminopropanoate 4-methylbenzenesulfonate, H-DL-Ala-OBzl.TosOH, H-Ala-obzl.tosoh, DL-Alanine benzyl ester 4-toluenesulfonate salt, H-DL-Ala-OBzl p-tosylate, benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid, Benzyl alaninate 4-methylbenzenesulfonate, D-Alanine benzyl ester p-toluenesulfonate salt, H-D-ALA-OBZL P-TOSYLATE