CAS 898208-96-3 is the registry number for 5-((3,5-Dimethylpiperidin-1-yl)sulfonyl)-3-methylbenzofuran-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid (CAS 898208-96-3) is a chemical compound with the molecular formula C17H21NO5S and a molecular weight of 351.4 g/mol. IUPAC name: 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid. InChIKey: NYSYYVATXNVNCP-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 5-(3,5-dimethylpiperidin-1-yl)sulfonyl-3-methyl-1-benzofuran-2-carboxylic acid |
| InChIKey | NYSYYVATXNVNCP-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)S(=O)(=O)C2=CC3=C(C=C2)OC(=C3C)C(=O)O)C |
Computed by PubChem (NCBI)