Products 42854-62-6
CAS 42854-62-6 appears in our catalog under these names: L-Alanine benzyl ester 4-toluenesulfonate, 97%, L-Alanine benzyl ester p-toluenesulfonate salt, H–Ala–OBzl·TosOH, H-L-Ala-OBzl*Tos, L-Alanine Benzyl Ester p-Toluenesulfonate, >98.0%(HPLC)(T). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Iris Biotech. Available pack sizes: 5g, 100g, 500g, 25g, on request, 10g, 2g, 1g.
Benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid (CAS 42854-62-6) is a chemical compound with the molecular formula C17H21NO5S and a molecular weight of 351.4 g/mol. IUPAC name: benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid. InChIKey: NWOPHJSSBMABBD-UHFFFAOYSA-N.
| Molecular formula | C17H21NO5S |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid |
| InChIKey | NWOPHJSSBMABBD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)
Synonyms:
O-Benzyl-L-alanine toluene-p-sulphonate, Benzyl 2-aminopropanoate 4-methylbenzenesulfonate, H-DL-Ala-OBzl.TosOH, H-Ala-obzl.tosoh, DL-Alanine benzyl ester 4-toluenesulfonate salt, H-DL-Ala-OBzl p-tosylate, L-Alanine benzyl ester 4-toluenesulfonate, benzyl 2-aminopropanoate;4-methylbenzenesulfonic acid, Benzyl alaninate 4-methylbenzenesulfonate, D-Alanine benzyl ester p-toluenesulfonate salt