CAS 34550-41-9 appears in our catalog under these names: 4H-1,2,4-Triazole-3,5-dicarboxylic Acid, 1H-1,2,4-Triazole-3,5-dicarboxylic acid 97%, 4H-1,2,4-triazole-3,5-dicarboxylic acid, 97%, 97%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 100mg, 50mg, 250mg, 1g.
1H-1,2,4-triazole-3,5-dicarboxylic acid (CAS 34550-41-9) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 1H-1,2,4-triazole-3,5-dicarboxylic acid. InChIKey: UJXWDYHVZBKHMB-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 1H-1,2,4-triazole-3,5-dicarboxylic acid |
| InChIKey | UJXWDYHVZBKHMB-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NN1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)