Products 346698-89-3
CAS 346698-89-3 is the registry number for (2,5-Dichlorophenyl)(4-methylpiperazin-1-yl)methanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
(2,5-dichlorophenyl)-(4-methylpiperazin-1-yl)methanone (CAS 346698-89-3) is a chemical compound with the molecular formula C12H14Cl2N2O and a molecular weight of 273.15 g/mol. IUPAC name: (2,5-dichlorophenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: WZSRXRVGJUPXSY-UHFFFAOYSA-N.
| Molecular formula | C12H14Cl2N2O |
|---|---|
| Molecular weight | 273.15 g/mol |
| IUPAC name | (2,5-dichlorophenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | WZSRXRVGJUPXSY-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=C(C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)