CAS 3470-45-9 appears in our catalog under these names: 1-Indanone-5-carboxylic acid, 98%, 1-Oxo-indan-5-carboxylicacid, 1-Indanone-5-carboxylic acid 98%, 1-Indanone-5-carboxylic acid, 98%, 98%, 1-Indanone-5-carboxylic acid, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g.
1-oxo-2,3-dihydroindene-5-carboxylic acid (CAS 3470-45-9) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 1-oxo-2,3-dihydroindene-5-carboxylic acid. InChIKey: SLLCLJRVOCBDTC-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 1-oxo-2,3-dihydroindene-5-carboxylic acid |
| InChIKey | SLLCLJRVOCBDTC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)