CAS 34785-07-4 appears in our catalog under these names: 6-Methoxy-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95+%, 6-Methoxy-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
6-methoxy-4-oxo-1H-quinoline-3-carboxylic acid (CAS 34785-07-4) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 6-methoxy-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: YUXLPEGMXYHPCZ-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 6-methoxy-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | YUXLPEGMXYHPCZ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)