Products 5493-24-3

CAS 5493-24-3 appears in our catalog under these names: (1,3-Dioxoisoindolin-2-yl)methyl acetate, 95%, (1,3–Dioxoisoindolin–2–yl)methyl acetate, (1,3-Dioxoisoindolin-2-YL)Methyl Acetate, 97%, 97%, (1,3-Dioxoisoindolin-2-yl)methyl acetate, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g, 10g.

Structural formula: {0} (CAS {1})

(1,3-dioxoisoindol-2-yl)methyl acetate (CAS 5493-24-3) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: (1,3-dioxoisoindol-2-yl)methyl acetate. InChIKey: TUKNTJVUVGIEQA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO4
Molecular weight219.19 g/mol
IUPAC name(1,3-dioxoisoindol-2-yl)methyl acetate
InChIKeyTUKNTJVUVGIEQA-UHFFFAOYSA-N
SMILESCC(=O)OCN1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)