CAS 203626-45-3 appears in our catalog under these names: 3,4-Diacetoxybenzonitrile, 95%, 3,4-Diacetoxybenzonitrile. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 25g, 10g.
(2-acetyloxy-4-cyanophenyl) acetate (CAS 203626-45-3) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: (2-acetyloxy-4-cyanophenyl) acetate. InChIKey: OYRIDYHXQXSNCH-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | (2-acetyloxy-4-cyanophenyl) acetate |
| InChIKey | OYRIDYHXQXSNCH-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)C#N)OC(=O)C |
Computed by PubChem (NCBI)