CAS 668971-56-0 appears in our catalog under these names: 5-(3-Methoxyphenyl)isoxazole-3-carboxylic acid, 95%, 5-(3-Methoxyphenyl)isoxazole-3-carboxylic acid, 95%, 95%, 5-(3-Methoxy-phenyl)-isoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 668971-56-0) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: MQNOGHHJKQIZKN-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 5-(3-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | MQNOGHHJKQIZKN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)