CAS 137247-85-9 is the registry number for 2-Ethyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
2-ethyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 137247-85-9) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 2-ethyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: FMHDMAFJLDZEKG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2-ethyl-1,3-dioxoisoindole-5-carboxylic acid |
| InChIKey | FMHDMAFJLDZEKG-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)