Products 137247-85-9

CAS 137247-85-9 is the registry number for 2-Ethyl-1,3-dioxoisoindoline-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-ethyl-1,3-dioxoisoindole-5-carboxylic acid (CAS 137247-85-9) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 2-ethyl-1,3-dioxoisoindole-5-carboxylic acid. InChIKey: FMHDMAFJLDZEKG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO4
Molecular weight219.19 g/mol
IUPAC name2-ethyl-1,3-dioxoisoindole-5-carboxylic acid
InChIKeyFMHDMAFJLDZEKG-UHFFFAOYSA-N
SMILESCCN1C(=O)C2=C(C1=O)C=C(C=C2)C(=O)O

Computed by PubChem (NCBI)