CAS 58337-23-8 appears in our catalog under these names: 2-Anilino-4-oxo-4,5-dihydrofuran-3-carboxylic acid, 95%, 4-Oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylic acid, 97%, 4-Oxo-2-(phenylamino)-4,5-dihydrofuran-3-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-anilino-4-oxofuran-3-carboxylic acid (CAS 58337-23-8) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 2-anilino-4-oxofuran-3-carboxylic acid. InChIKey: TWMQSQKWJTXETM-UHFFFAOYSA-N.
| Molecular formula | C11H9NO4 |
|---|---|
| Molecular weight | 219.19 g/mol |
| IUPAC name | 2-anilino-4-oxofuran-3-carboxylic acid |
| InChIKey | TWMQSQKWJTXETM-UHFFFAOYSA-N |
| SMILES | C1C(=O)C(=C(O1)NC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)