Products 34859-78-4
CAS 34859-78-4 is the registry number for 1-Nitro-4-(4-(trifluoromethyl)phenoxy)benzene, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene (CAS 34859-78-4) is a chemical compound with the molecular formula C13H8F3NO3 and a molecular weight of 283.20 g/mol. IUPAC name: 1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene. InChIKey: PYMCMCZNGHSQLC-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NO3 |
|---|---|
| Molecular weight | 283.20 g/mol |
| IUPAC name | 1-(4-nitrophenoxy)-4-(trifluoromethyl)benzene |
| InChIKey | PYMCMCZNGHSQLC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)