CAS 349-00-8 appears in our catalog under these names: (2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid, 97%, N–(2,2,2–Trifluoroacetyl)–L–valine, (2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid, (2S)-3-Methyl-2-(trifluoroacetamido)butanoic acid, 97%, 97%, N-(2,2,2-Trifluoroacetyl)-L-valine, 97%. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 2,5g, 100mg, 250mg.
(2S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid (CAS 349-00-8) is a chemical compound with the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. IUPAC name: (2S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid. InChIKey: XZNJCFYYNFONPC-BYPYZUCNSA-N.
| Molecular formula | C7H10F3NO3 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (2S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]butanoic acid |
| InChIKey | XZNJCFYYNFONPC-BYPYZUCNSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)