CAS 34911-21-2 appears in our catalog under these names: 7-Chloro-4-methoxy-1-indanone, 95%, 7-Chloro-4-methoxy-2,3-dihydro-1H-inden-1-one, 98%, 98%, 7-Chloro-4-methoxy-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
7-chloro-4-methoxy-2,3-dihydroinden-1-one (CAS 34911-21-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 7-chloro-4-methoxy-2,3-dihydroinden-1-one. InChIKey: GPMBKEXYPRPZEL-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 7-chloro-4-methoxy-2,3-dihydroinden-1-one |
| InChIKey | GPMBKEXYPRPZEL-UHFFFAOYSA-N |
| SMILES | COC1=C2CCC(=O)C2=C(C=C1)Cl |
Computed by PubChem (NCBI)