Products 349471-65-4

CAS 349471-65-4 appears in our catalog under these names: 4–Bromo–3–hydroxy–2–pyridinecarboxylic acid, 4-Bromo-3-hydroxypyridine-2-carboxylic acid. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-bromo-3-hydroxypyridine-2-carboxylic acid (CAS 349471-65-4) is a chemical compound with the molecular formula C6H4BrNO3 and a molecular weight of 218.00 g/mol. IUPAC name: 4-bromo-3-hydroxypyridine-2-carboxylic acid. InChIKey: HTNFRWNPQNKTAU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrNO3
Molecular weight218.00 g/mol
IUPAC name4-bromo-3-hydroxypyridine-2-carboxylic acid
InChIKeyHTNFRWNPQNKTAU-UHFFFAOYSA-N
SMILESC1=CN=C(C(=C1Br)O)C(=O)O

Computed by PubChem (NCBI)