Products 351066-81-4

CAS 351066-81-4 is the registry number for 1-(4-Isopropoxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

5-oxo-1-(4-propan-2-yloxyphenyl)pyrrolidine-3-carboxylic acid (CAS 351066-81-4) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 5-oxo-1-(4-propan-2-yloxyphenyl)pyrrolidine-3-carboxylic acid. InChIKey: VJAKUPPPTKCJFX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO4
Molecular weight263.29 g/mol
IUPAC name5-oxo-1-(4-propan-2-yloxyphenyl)pyrrolidine-3-carboxylic acid
InChIKeyVJAKUPPPTKCJFX-UHFFFAOYSA-N
SMILESCC(C)OC1=CC=C(C=C1)N2CC(CC2=O)C(=O)O

Computed by PubChem (NCBI)