Products 351465-72-0
CAS 351465-72-0 is the registry number for 4-((6-Carboxycyclohex-3-ene-1-carboxamido)methyl)benzoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 100mg, 250mg.
4-[[(6-carboxycyclohex-3-ene-1-carbonyl)amino]methyl]benzoic acid (CAS 351465-72-0) is a chemical compound with the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. IUPAC name: 4-[[(6-carboxycyclohex-3-ene-1-carbonyl)amino]methyl]benzoic acid. InChIKey: KDILGXQBRXISBN-UHFFFAOYSA-N.
| Molecular formula | C16H17NO5 |
|---|---|
| Molecular weight | 303.31 g/mol |
| IUPAC name | 4-[[(6-carboxycyclohex-3-ene-1-carbonyl)amino]methyl]benzoic acid |
| InChIKey | KDILGXQBRXISBN-UHFFFAOYSA-N |
| SMILES | C1C=CCC(C1C(=O)NCC2=CC=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)