CAS 352525-92-9 appears in our catalog under these names: B-[(1E)-2-(4-Cyanophenyl)ethenyl]boronic acid, 97%, 97%, (E)-(4-Cyanostyryl)boronic acid, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
[(E)-2-(4-cyanophenyl)ethenyl]boronic acid (CAS 352525-92-9) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: [(E)-2-(4-cyanophenyl)ethenyl]boronic acid. InChIKey: PKFRJEHEHFQVTM-AATRIKPKSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | [(E)-2-(4-cyanophenyl)ethenyl]boronic acid |
| InChIKey | PKFRJEHEHFQVTM-AATRIKPKSA-N |
| SMILES | B(/C=C/C1=CC=C(C=C1)C#N)(O)O |
Computed by PubChem (NCBI)