CAS 35274-53-4 appears in our catalog under these names: 2-Bromo-3,4,5-trimethoxybenzaldehyde, 97%, 2-Bromo-3,4,5-trimethoxybenzaldehyde, 95%, 2-Bromo-3,4,5-trimethoxybenzaldehyde 95%, 2-Bromo-3,4,5-trimethoxybenzaldehyde, 95%, 95%, 2-Bromo-3,4,5-trimethoxy-benzaldehyde, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100mg, 250mg, 5g.
2-bromo-3,4,5-trimethoxybenzaldehyde (CAS 35274-53-4) is a chemical compound with the molecular formula C10H11BrO4 and a molecular weight of 275.10 g/mol. IUPAC name: 2-bromo-3,4,5-trimethoxybenzaldehyde. InChIKey: LADPQZFHJVANIP-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO4 |
|---|---|
| Molecular weight | 275.10 g/mol |
| IUPAC name | 2-bromo-3,4,5-trimethoxybenzaldehyde |
| InChIKey | LADPQZFHJVANIP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)Br)OC)OC |
Computed by PubChem (NCBI)