CAS 35340-63-7 appears in our catalog under these names: 4-(Benzoylamino)butanoic acid, 95%, 4–Benzamidobutanoic acid, 4-Benzamidobutanoic acid, 96%, 96%, 4-Benzamidobutanoic acid, 96%, 4-Benzamidobutanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
4-benzamidobutanoic acid (CAS 35340-63-7) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 4-benzamidobutanoic acid. InChIKey: BOZHPKGNNJPZKV-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 4-benzamidobutanoic acid |
| InChIKey | BOZHPKGNNJPZKV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCCCC(=O)O |
Computed by PubChem (NCBI)