CAS 353746-54-0 is the registry number for 2-{3,5-Dioxo-4-azatricyclo(5.2.1.0,2,6)dec-8-en-4-yl}propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoic acid (CAS 353746-54-0) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoic acid. InChIKey: APZVLLMAEAFDCJ-UHFFFAOYSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)propanoic acid |
| InChIKey | APZVLLMAEAFDCJ-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C=C3 |
Computed by PubChem (NCBI)