CAS 357263-49-1 appears in our catalog under these names: Methyl 7-azaindole-3-glyoxylate, 95%, Methyl 7-Azaindole-3-glyoxylate. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg, 50mg.
Methyl 2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate (CAS 357263-49-1) is a chemical compound with the molecular formula C10H8N2O3 and a molecular weight of 204.18 g/mol. IUPAC name: methyl 2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate. InChIKey: LXGPNHJNIRDJER-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O3 |
|---|---|
| Molecular weight | 204.18 g/mol |
| IUPAC name | methyl 2-oxo-2-(1H-pyrrolo[2,3-b]pyridin-3-yl)acetate |
| InChIKey | LXGPNHJNIRDJER-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CNC2=C1C=CC=N2 |
Computed by PubChem (NCBI)