Products 357611-51-9
CAS 357611-51-9 appears in our catalog under these names: 3,5–Dimethyl–4–propoxyphenylboronic Acid (contains varying amounts of Anhydride), 3,5-Dimethyl-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride), 4-Propoxy-3,5-dimethylphenylboronic acid, 98%, 98%, 3,5-Dimethyl-4-propoxyphenylboronic acid, 98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100g.
(3,5-dimethyl-4-propoxyphenyl)boronic acid (CAS 357611-51-9) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (3,5-dimethyl-4-propoxyphenyl)boronic acid. InChIKey: ISUPZUFVQLUFLM-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (3,5-dimethyl-4-propoxyphenyl)boronic acid |
| InChIKey | ISUPZUFVQLUFLM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)OCCC)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3,5-Dimethyl-4-propoxyphenylboronic Acid (contains varying amounts of Anhydride), 3,5-Dimethyl-4-propoxyphenylboronic acid, (3,5-dimethyl-4-propoxyphenyl)boronic acid, 4-Propoxy-3,5-dimethylphenylboronic acid, 3,5-Dimethyl-4-propoxybenzeneboronic Acid, (3,5-dimethyl-4-propoxy-phenyl)boronic acid, 3,5-Dimethyl-4-propoxyphenylboronic Acid (contains varying amounts of A