CAS 35826-31-4 appears in our catalog under these names: 3–Amino–4–phenylaminopyridine, 4-N-Phenylpyridine-3,4-diamine. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-N-phenylpyridine-3,4-diamine (CAS 35826-31-4) is a chemical compound with the molecular formula C11H11N3 and a molecular weight of 185.22 g/mol. IUPAC name: 4-N-phenylpyridine-3,4-diamine. InChIKey: FVUVDAATDDOHKA-UHFFFAOYSA-N.
| Molecular formula | C11H11N3 |
|---|---|
| Molecular weight | 185.22 g/mol |
| IUPAC name | 4-N-phenylpyridine-3,4-diamine |
| InChIKey | FVUVDAATDDOHKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=NC=C2)N |
Computed by PubChem (NCBI)