CAS 3594-36-3 is the registry number for 1,3-Bis(4-methylphenyl)propane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1,3-bis(4-methylphenyl)propane-1,3-dione (CAS 3594-36-3) is a chemical compound with the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. IUPAC name: 1,3-bis(4-methylphenyl)propane-1,3-dione. InChIKey: XKFZOWRFWMXGQG-UHFFFAOYSA-N.
| Molecular formula | C17H16O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 1,3-bis(4-methylphenyl)propane-1,3-dione |
| InChIKey | XKFZOWRFWMXGQG-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CC(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)