Products 359828-69-6
CAS 359828-69-6 is the registry number for 2,6-Dichloro-α-ethylbenzeneacetic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,6-dichlorophenyl)butanoic acid (CAS 359828-69-6) is a chemical compound with the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)butanoic acid. InChIKey: WFHGNNOTEUNRRD-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2O2 |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)butanoic acid |
| InChIKey | WFHGNNOTEUNRRD-UHFFFAOYSA-N |
| SMILES | CCC(C1=C(C=CC=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-(2,6-dichlorophenyl)butanoic Acid, 2,6-Dichloro-alpha-ethylbenzeneacetic acid, Benzeneacetic acid, 2,6-dichloro-alpha-ethyl-, 2,6-Dichloro-|A-ethylbenzeneacetic acid, 2,6-Dichloro-I+/--ethylbenzeneacetic acid, Benzeneacetic acid, 2,6-dichloro-?-ethyl-, Benzeneacetic acid, 2,6-dichloro-|A-ethyl-