Products 35998-96-0
CAS 35998-96-0 appears in our catalog under these names: Methyl 5-amino-2-nitrobenzoate, 97%, 5–Amino–2–nitro–benzoic acid methyl ester, Methyl 5-amino-2-nitrobenzoate 97%, Methyl 5-Amino-2-nitrobenzoate, 95%, 95%, Methyl 5-amino-2-nitrobenzoate, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg.
Methyl 5-amino-2-nitrobenzoate (CAS 35998-96-0) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: methyl 5-amino-2-nitrobenzoate. InChIKey: HBQRFDGMJZUGQV-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | methyl 5-amino-2-nitrobenzoate |
| InChIKey | HBQRFDGMJZUGQV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)